C10H16N2O4S2 — CID 81204690
[4-[5-(aminomethyl)thiophen-2-yl]sulfonylmorpholin-2-yl]methanol (PubChem CID 81204690) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is [4-[5-(aminomethyl)thiophen-2-yl]sulfonylmorpholin-2-yl]methanol.
| Compound Name | [4-[5-(aminomethyl)thiophen-2-yl]sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81204690 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [4-[5-(aminomethyl)thiophen-2-yl]sulfonylmorpholin-2-yl]methanol |
| SMILES | NCc1ccc(S(=O)(=O)N2CCOC(CO)C2)s1 |
| InChI | InChI=1S/C10H16N2O4S2/c11-5-9-1-2-10(17-9)18(14,15)12-3-4-16-8(6-12)7-13/h1-2,8,13H,3-7,11H2 |
| InChIKey | NFVSOHCAOOAFTJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |