C11H13Br2NO4S — CID 81219809
[4-(2,4-dibromophenyl)sulfonylmorpholin-2-yl]methanol (PubChem CID 81219809) has the molecular formula C11H13Br2NO4S and a molecular weight of 415.10 g/mol. Its IUPAC name is [4-(2,4-dibromophenyl)sulfonylmorpholin-2-yl]methanol.
| Compound Name | [4-(2,4-dibromophenyl)sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81219809 |
| Molecular Formula | C11H13Br2NO4S |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | [4-(2,4-dibromophenyl)sulfonylmorpholin-2-yl]methanol |
| SMILES | O=S(=O)(c1ccc(Br)cc1Br)N1CCOC(CO)C1 |
| InChI | InChI=1S/C11H13Br2NO4S/c12-8-1-2-11(10(13)5-8)19(16,17)14-3-4-18-9(6-14)7-15/h1-2,5,9,15H,3-4,6-7H2 |
| InChIKey | NBPPNDXSDUEOEY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |