C11H15N3O6S — CID 81213005
[4-(4-amino-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol (PubChem CID 81213005) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is [4-(4-amino-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-amino-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81213005 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [4-(4-amino-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol |
| SMILES | Nc1ccc(S(=O)(=O)N2CCOC(CO)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N3O6S/c12-8-1-2-11(10(5-8)14(16)17)21(18,19)13-3-4-20-9(6-13)7-15/h1-2,5,9,15H,3-4,6-7,12H2 |
| InChIKey | WUAQQVYADWVPLN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|