C11H13FN2O6S — CID 81208677
[4-(4-fluoro-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol (PubChem CID 81208677) has the molecular formula C11H13FN2O6S and a molecular weight of 320.30 g/mol. Its IUPAC name is [4-(4-fluoro-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-fluoro-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81208677 |
| Molecular Formula | C11H13FN2O6S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [4-(4-fluoro-2-nitrophenyl)sulfonylmorpholin-2-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(F)ccc1S(=O)(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C11H13FN2O6S/c12-8-1-2-11(10(5-8)14(16)17)21(18,19)13-3-4-20-9(6-13)7-15/h1-2,5,9,15H,3-4,6-7H2 |
| InChIKey | SZMNAEVBUUMYAA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|