C12H15BrFNO3S — CID 81212406
2-(bromomethyl)-4-(4-fluoro-2-methylphenyl)sulfonylmorpholine (PubChem CID 81212406) has the molecular formula C12H15BrFNO3S and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(4-fluoro-2-methylphenyl)sulfonylmorpholine.
| Compound Name | 2-(bromomethyl)-4-(4-fluoro-2-methylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 81212406 |
| Molecular Formula | C12H15BrFNO3S |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-(bromomethyl)-4-(4-fluoro-2-methylphenyl)sulfonylmorpholine |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C12H15BrFNO3S/c1-9-6-10(14)2-3-12(9)19(16,17)15-4-5-18-11(7-13)8-15/h2-3,6,11H,4-5,7-8H2,1H3 |
| InChIKey | JGBGIAYPRFWUFD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|