C11H12BrCl2NO3S — CID 81212002
2-(bromomethyl)-4-(3,4-dichlorophenyl)sulfonylmorpholine (PubChem CID 81212002) has the molecular formula C11H12BrCl2NO3S and a molecular weight of 389.10 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(3,4-dichlorophenyl)sulfonylmorpholine.
| Compound Name | 2-(bromomethyl)-4-(3,4-dichlorophenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 81212002 |
| Molecular Formula | C11H12BrCl2NO3S |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 2-(bromomethyl)-4-(3,4-dichlorophenyl)sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C11H12BrCl2NO3S/c12-6-8-7-15(3-4-18-8)19(16,17)9-1-2-10(13)11(14)5-9/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | FUOZJQQEYIMERZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|