C8H12BrN3O3S — CID 102694002
2-(bromomethyl)-4-(1H-pyrazol-5-ylsulfonyl)morpholine (PubChem CID 102694002) has the molecular formula C8H12BrN3O3S and a molecular weight of 310.17 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(1H-pyrazol-5-ylsulfonyl)morpholine.
| Compound Name | 2-(bromomethyl)-4-(1H-pyrazol-5-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 102694002 |
| Molecular Formula | C8H12BrN3O3S |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-(bromomethyl)-4-(1H-pyrazol-5-ylsulfonyl)morpholine |
| SMILES | O=S(=O)(c1ccn[nH]1)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C8H12BrN3O3S/c9-5-7-6-12(3-4-15-7)16(13,14)8-1-2-10-11-8/h1-2,7H,3-6H2,(H,10,11) |
| InChIKey | RTEMEIBQJJMRDJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|