C13H24N4O2S — CID 102692300
N-ethyl-N-[[1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-yl]methyl]ethanamine (PubChem CID 102692300) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-ethyl-N-[[1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-ethyl-N-[[1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 102692300 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-ethyl-N-[[1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-yl]methyl]ethanamine |
| SMILES | CCN(CC)CC1CCN(S(=O)(=O)c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C13H24N4O2S/c1-3-16(4-2)11-12-6-9-17(10-7-12)20(18,19)13-5-8-14-15-13/h5,8,12H,3-4,6-7,9-11H2,1-2H3,(H,14,15) |
| InChIKey | AGXRKOGWWCQHQK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |