C9H13F3N4O2S — CID 102691873
1-(1H-pyrazol-5-ylsulfonyl)-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 102691873) has the molecular formula C9H13F3N4O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-ylsulfonyl)-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(1H-pyrazol-5-ylsulfonyl)-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 102691873 |
| Molecular Formula | C9H13F3N4O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(1H-pyrazol-5-ylsulfonyl)-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | O=S(=O)(c1ccn[nH]1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3N4O2S/c10-9(11,12)7-15-3-5-16(6-4-15)19(17,18)8-1-2-13-14-8/h1-2H,3-7H2,(H,13,14) |
| InChIKey | HYSYROLARXTBCE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |