C9H14F3N3O2S — CID 102692155
N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692155) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692155 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCCCN(CC(F)(F)F)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H14F3N3O2S/c1-2-3-6-15(7-9(10,11)12)18(16,17)8-4-5-13-14-8/h4-5H,2-3,6-7H2,1H3,(H,13,14) |
| InChIKey | CXSORKQWKOOIEC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |