C10H16F3N3O2S — CID 102692181
N-pentan-3-yl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692181) has the molecular formula C10H16F3N3O2S and a molecular weight of 299.32 g/mol. Its IUPAC name is N-pentan-3-yl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-pentan-3-yl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692181 |
| Molecular Formula | C10H16F3N3O2S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-pentan-3-yl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCC(CC)N(CC(F)(F)F)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H16F3N3O2S/c1-3-8(4-2)16(7-10(11,12)13)19(17,18)9-5-6-14-15-9/h5-6,8H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | SARWKOSTIMOYQK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |