C9H12F3N3O2S — CID 102692807
1-(1H-pyrazol-5-ylsulfonyl)-3-(trifluoromethyl)piperidine (PubChem CID 102692807) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.27 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-ylsulfonyl)-3-(trifluoromethyl)piperidine.
| Compound Name | 1-(1H-pyrazol-5-ylsulfonyl)-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 102692807 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-(1H-pyrazol-5-ylsulfonyl)-3-(trifluoromethyl)piperidine |
| SMILES | O=S(=O)(c1ccn[nH]1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H12F3N3O2S/c10-9(11,12)7-2-1-5-15(6-7)18(16,17)8-3-4-13-14-8/h3-4,7H,1-2,5-6H2,(H,13,14) |
| InChIKey | GAJVMIQZHAOIAO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |