C10H11N3O5S — CID 102690954
5-(1H-pyrazol-5-ylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione (PubChem CID 102690954) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-(1H-pyrazol-5-ylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione.
| Compound Name | 5-(1H-pyrazol-5-ylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 102690954 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-(1H-pyrazol-5-ylsulfonyl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C1OC(=O)C2CN(S(=O)(=O)c3ccn[nH]3)CCC12 |
| InChI | InChI=1S/C10H11N3O5S/c14-9-6-2-4-13(5-7(6)10(15)18-9)19(16,17)8-1-3-11-12-8/h1,3,6-7H,2,4-5H2,(H,11,12) |
| InChIKey | SWQXGOJTEWRIAU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|