C10H16ClN3O2S — CID 102693933
3-(2-chloroethyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine (PubChem CID 102693933) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine.
| Compound Name | 3-(2-chloroethyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 102693933 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-(2-chloroethyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine |
| SMILES | O=S(=O)(c1ccn[nH]1)N1CCCC(CCCl)C1 |
| InChI | InChI=1S/C10H16ClN3O2S/c11-5-3-9-2-1-7-14(8-9)17(15,16)10-4-6-12-13-10/h4,6,9H,1-3,5,7-8H2,(H,12,13) |
| InChIKey | BQQXKUXRXWTFQC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|