C10H17N3O2S2 — CID 114238088
4-methylsulfanyl-1-(1H-pyrazol-5-ylsulfonyl)azepane (PubChem CID 114238088) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-methylsulfanyl-1-(1H-pyrazol-5-ylsulfonyl)azepane.
| Compound Name | 4-methylsulfanyl-1-(1H-pyrazol-5-ylsulfonyl)azepane |
|---|---|
| PubChem CID | 114238088 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-methylsulfanyl-1-(1H-pyrazol-5-ylsulfonyl)azepane |
| SMILES | CSC1CCCN(S(=O)(=O)c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-16-9-3-2-7-13(8-5-9)17(14,15)10-4-6-11-12-10/h4,6,9H,2-3,5,7-8H2,1H3,(H,11,12) |
| InChIKey | YGLHPXIOPCYBDR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |