C10H17N3O2S — CID 102693060
3,3-dimethyl-1-(1H-pyrazol-5-ylsulfonyl)piperidine (PubChem CID 102693060) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1H-pyrazol-5-ylsulfonyl)piperidine.
| Compound Name | 3,3-dimethyl-1-(1H-pyrazol-5-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 102693060 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3,3-dimethyl-1-(1H-pyrazol-5-ylsulfonyl)piperidine |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2ccn[nH]2)C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-10(2)5-3-7-13(8-10)16(14,15)9-4-6-11-12-9/h4,6H,3,5,7-8H2,1-2H3,(H,11,12) |
| InChIKey | KKWCXVCLYHQKMC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |