C9H15N3O2S2 — CID 102693433
2,2-dimethyl-4-(1H-pyrazol-5-ylsulfonyl)thiomorpholine (PubChem CID 102693433) has the molecular formula C9H15N3O2S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1H-pyrazol-5-ylsulfonyl)thiomorpholine.
| Compound Name | 2,2-dimethyl-4-(1H-pyrazol-5-ylsulfonyl)thiomorpholine |
|---|---|
| PubChem CID | 102693433 |
| Molecular Formula | C9H15N3O2S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2,2-dimethyl-4-(1H-pyrazol-5-ylsulfonyl)thiomorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccn[nH]2)CCS1 |
| InChI | InChI=1S/C9H15N3O2S2/c1-9(2)7-12(5-6-15-9)16(13,14)8-3-4-10-11-8/h3-4H,5-7H2,1-2H3,(H,10,11) |
| InChIKey | PJUZNBSNOQUJPF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |