C11H15ClN2O2S2 — CID 115683090
4-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine (PubChem CID 115683090) has the molecular formula C11H15ClN2O2S2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine.
| Compound Name | 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine |
|---|---|
| PubChem CID | 115683090 |
| Molecular Formula | C11H15ClN2O2S2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccc(Cl)nc2)CCS1 |
| InChI | InChI=1S/C11H15ClN2O2S2/c1-11(2)8-14(5-6-17-11)18(15,16)9-3-4-10(12)13-7-9/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | QMYUHQNGURJWGO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|