C13H15FN2O2S2 — CID 115683060
5-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-fluorobenzonitrile (PubChem CID 115683060) has the molecular formula C13H15FN2O2S2 and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-fluorobenzonitrile.
| Compound Name | 5-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 115683060 |
| Molecular Formula | C13H15FN2O2S2 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-fluorobenzonitrile |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccc(F)c(C#N)c2)CCS1 |
| InChI | InChI=1S/C13H15FN2O2S2/c1-13(2)9-16(5-6-19-13)20(17,18)11-3-4-12(14)10(7-11)8-15/h3-4,7H,5-6,9H2,1-2H3 |
| InChIKey | LAJOGEDLSCLNGA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |