C14H17FN2O2S — CID 63239382
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzonitrile (PubChem CID 63239382) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzonitrile.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 63239382 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzonitrile |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(F)c(C#N)c2)C1 |
| InChI | InChI=1S/C14H17FN2O2S/c1-10-5-11(2)9-17(8-10)20(18,19)13-3-4-14(15)12(6-13)7-16/h3-4,6,10-11H,5,8-9H2,1-2H3 |
| InChIKey | DCMQRGICWAYIDB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |