C11H11FN2O4S2 — CID 63262428
5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-fluorobenzonitrile (PubChem CID 63262428) has the molecular formula C11H11FN2O4S2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 63262428 |
| Molecular Formula | C11H11FN2O4S2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(S(=O)(=O)N2CCS(=O)(=O)CC2)ccc1F |
| InChI | InChI=1S/C11H11FN2O4S2/c12-11-2-1-10(7-9(11)8-13)20(17,18)14-3-5-19(15,16)6-4-14/h1-2,7H,3-6H2 |
| InChIKey | VFGUCRZMKIDHAW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |