C12H16FNO4S3 — CID 114791781
3-(2,2-dimethylthiomorpholin-4-yl)sulfonylbenzenesulfonyl fluoride (PubChem CID 114791781) has the molecular formula C12H16FNO4S3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-(2,2-dimethylthiomorpholin-4-yl)sulfonylbenzenesulfonyl fluoride.
| Compound Name | 3-(2,2-dimethylthiomorpholin-4-yl)sulfonylbenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791781 |
| Molecular Formula | C12H16FNO4S3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 3-(2,2-dimethylthiomorpholin-4-yl)sulfonylbenzenesulfonyl fluoride |
| SMILES | CC1(C)CN(S(=O)(=O)c2cccc(S(=O)(=O)F)c2)CCS1 |
| InChI | InChI=1S/C12H16FNO4S3/c1-12(2)9-14(6-7-19-12)21(17,18)11-5-3-4-10(8-11)20(13,15)16/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | ZIZUBBSVJYDRNX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |