C11H15BrN2O2S2 — CID 113252456
4-[(5-bromo-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine (PubChem CID 113252456) has the molecular formula C11H15BrN2O2S2 and a molecular weight of 351.29 g/mol. Its IUPAC name is 4-[(5-bromo-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine.
| Compound Name | 4-[(5-bromo-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine |
|---|---|
| PubChem CID | 113252456 |
| Molecular Formula | C11H15BrN2O2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-[(5-bromo-3-pyridinyl)sulfonyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)c2cncc(Br)c2)CCS1 |
| InChI | InChI=1S/C11H15BrN2O2S2/c1-11(2)8-14(3-4-17-11)18(15,16)10-5-9(12)6-13-7-10/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | HBMLEVUBILBICV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |