C12H17BrN2S — CID 115683590
4-[(5-bromo-3-pyridinyl)methyl]-2,2-dimethylthiomorpholine (PubChem CID 115683590) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 4-[(5-bromo-3-pyridinyl)methyl]-2,2-dimethylthiomorpholine.
| Compound Name | 4-[(5-bromo-3-pyridinyl)methyl]-2,2-dimethylthiomorpholine |
|---|---|
| PubChem CID | 115683590 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-[(5-bromo-3-pyridinyl)methyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(Cc2cncc(Br)c2)CCS1 |
| InChI | InChI=1S/C12H17BrN2S/c1-12(2)9-15(3-4-16-12)8-10-5-11(13)7-14-6-10/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | OJXBOQFOOFAVDA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |