C13H19BrN2O2S2 — CID 114380320
5-bromo-3-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-methylaniline (PubChem CID 114380320) has the molecular formula C13H19BrN2O2S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is 5-bromo-3-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-methylaniline.
| Compound Name | 5-bromo-3-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-methylaniline |
|---|---|
| PubChem CID | 114380320 |
| Molecular Formula | C13H19BrN2O2S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 5-bromo-3-(2,2-dimethylthiomorpholin-4-yl)sulfonyl-2-methylaniline |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C13H19BrN2O2S2/c1-9-11(15)6-10(14)7-12(9)20(17,18)16-4-5-19-13(2,3)8-16/h6-7H,4-5,8,15H2,1-3H3 |
| InChIKey | IIBWPVAHCNDMNG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|