C11H15BrN2O2S — CID 114380220
3-amino-5-bromo-2-methyl-N-(1-methylcyclopropyl)benzenesulfonamide (PubChem CID 114380220) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(1-methylcyclopropyl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(1-methylcyclopropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114380220 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(1-methylcyclopropyl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NC1(C)CC1 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-7-9(13)5-8(12)6-10(7)17(15,16)14-11(2)3-4-11/h5-6,14H,3-4,13H2,1-2H3 |
| InChIKey | PQGAVXRIUOJNPQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|