C10H11BrN4O3S — CID 114380304
3-amino-5-bromo-2-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide (PubChem CID 114380304) has the molecular formula C10H11BrN4O3S and a molecular weight of 347.19 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114380304 |
| Molecular Formula | C10H11BrN4O3S |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2cc(Br)cc(N)c2C)n1 |
| InChI | InChI=1S/C10H11BrN4O3S/c1-5-8(12)3-7(11)4-9(5)19(16,17)15-10-13-6(2)14-18-10/h3-4H,12H2,1-2H3,(H,13,14,15) |
| InChIKey | VXNWJJFXJCBHDY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|