C11H11BrN4O3S — CID 114380367
3-amino-5-bromo-2-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 114380367) has the molecular formula C11H11BrN4O3S and a molecular weight of 359.21 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114380367 |
| Molecular Formula | C11H11BrN4O3S |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C11H11BrN4O3S/c1-6-8(13)4-7(12)5-9(6)20(18,19)16-10-2-3-11(17)15-14-10/h2-5H,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | XWGIJZXEDWCCON-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|