C11H12BrN3O3S — CID 114378523
3-amino-5-bromo-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 114378523) has the molecular formula C11H12BrN3O3S and a molecular weight of 346.21 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114378523 |
| Molecular Formula | C11H12BrN3O3S |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Br)cc(N)c2C)no1 |
| InChI | InChI=1S/C11H12BrN3O3S/c1-6-3-11(14-18-6)15-19(16,17)10-5-8(12)4-9(13)7(10)2/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | XLXPRSAMCNAPAL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|