About 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide
2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide (PubChem CID 62149534) has the molecular formula C9H10N4O3S
and a molecular weight of 254.27 g/mol. Its IUPAC name is 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide |
| PubChem CID | 62149534 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cccnc2N)no1 |
| InChI | InChI=1S/C9H10N4O3S/c1-6-5-8(12-16-6)13-17(14,15)7-3-2-4-11-9(7)10/h2-5H,1H3,(H2,10,11)(H,12,13) |
| InChIKey | YGEQHPMGGAOXTO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide?
The IUPAC name of 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide (CID 62149534) is 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide.
What is the SMILES notation for 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide?
The canonical SMILES for 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide is Cc1cc(NS(=O)(=O)c2cccnc2N)no1.
What is the InChIKey of 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide?
The InChIKey is YGEQHPMGGAOXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3S/c1-6-5-8(12-16-6)13-17(14,15)7-3-2-4-11-9(7)10/h2-5H,1H3,(H2,10,11)(H,12,13).
What are the key properties of 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide?
2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide has a molecular weight of 254.27 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide is sourced from PubChem (CID 62149534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).