C11H13N3O4S — CID 43257220
4-amino-2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 43257220) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-amino-2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43257220 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-amino-2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | COc1cc(N)ccc1S(=O)(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C11H13N3O4S/c1-7-5-11(13-18-7)14-19(15,16)10-4-3-8(12)6-9(10)17-2/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | MDAWSHZTIHNLQT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|