C10H10FN3O3S — CID 22411411
4-amino-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 22411411) has the molecular formula C10H10FN3O3S and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22411411 |
| Molecular Formula | C10H10FN3O3S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-amino-2-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2F)no1 |
| InChI | InChI=1S/C10H10FN3O3S/c1-6-4-10(13-17-6)14-18(15,16)9-3-2-7(12)5-8(9)11/h2-5H,12H2,1H3,(H,13,14) |
| InChIKey | RRELFOAIHGTXMK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|