C10H8Cl2N2O3S — CID 717534
2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 717534) has the molecular formula C10H8Cl2N2O3S and a molecular weight of 307.16 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 717534 |
| Molecular Formula | C10H8Cl2N2O3S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 2,5-dichloro-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Cl)ccc2Cl)no1 |
| InChI | InChI=1S/C10H8Cl2N2O3S/c1-6-4-10(13-17-6)14-18(15,16)9-5-7(11)2-3-8(9)12/h2-5H,1H3,(H,13,14) |
| InChIKey | ZVEBDUNJTFURGF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |