C12H13Cl2N3O2S — CID 39854116
2,5-dichloro-N-(2-ethyl-5-methylpyrazol-3-yl)benzenesulfonamide (PubChem CID 39854116) has the molecular formula C12H13Cl2N3O2S and a molecular weight of 334.23 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-ethyl-5-methylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-ethyl-5-methylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 39854116 |
| Molecular Formula | C12H13Cl2N3O2S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2,5-dichloro-N-(2-ethyl-5-methylpyrazol-3-yl)benzenesulfonamide |
| SMILES | CCn1nc(C)cc1NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O2S/c1-3-17-12(6-8(2)15-17)16-20(18,19)11-7-9(13)4-5-10(11)14/h4-7,16H,3H2,1-2H3 |
| InChIKey | NEFDCXKLOHPJLM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |