C11H11Cl2N3O2S — CID 4769211
2,5-dichloro-N-(1,5-dimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 4769211) has the molecular formula C11H11Cl2N3O2S and a molecular weight of 320.20 g/mol. Its IUPAC name is 2,5-dichloro-N-(1,5-dimethylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(1,5-dimethylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4769211 |
| Molecular Formula | C11H11Cl2N3O2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2,5-dichloro-N-(1,5-dimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2cc(Cl)ccc2Cl)cnn1C |
| InChI | InChI=1S/C11H11Cl2N3O2S/c1-7-10(6-14-16(7)2)15-19(17,18)11-5-8(12)3-4-9(11)13/h3-6,15H,1-2H3 |
| InChIKey | BQRITBDXAGGDMQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |