C16H13Cl2N3O2S — CID 35521098
2,5-dichloro-N-[4-(3-methylpyrazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 35521098) has the molecular formula C16H13Cl2N3O2S and a molecular weight of 382.27 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(3-methylpyrazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[4-(3-methylpyrazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35521098 |
| Molecular Formula | C16H13Cl2N3O2S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 2,5-dichloro-N-[4-(3-methylpyrazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccn(-c2ccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)cc2)n1 |
| InChI | InChI=1S/C16H13Cl2N3O2S/c1-11-8-9-21(19-11)14-5-3-13(4-6-14)20-24(22,23)16-10-12(17)2-7-15(16)18/h2-10,20H,1H3 |
| InChIKey | LXEZCHJNGIDHBE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |