C16H12Cl2N2O2S — CID 11280072
2,5-dichloro-N-(2-methylquinolin-6-yl)benzenesulfonamide (PubChem CID 11280072) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-methylquinolin-6-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-methylquinolin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 11280072 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2,5-dichloro-N-(2-methylquinolin-6-yl)benzenesulfonamide |
| SMILES | Cc1ccc2cc(NS(=O)(=O)c3cc(Cl)ccc3Cl)ccc2n1 |
| InChI | InChI=1S/C16H12Cl2N2O2S/c1-10-2-3-11-8-13(5-7-15(11)19-10)20-23(21,22)16-9-12(17)4-6-14(16)18/h2-9,20H,1H3 |
| InChIKey | WMIMKCBTHIMZMR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |