C25H19ClN4O4S — CID 167306517
N-[3-chloro-4-(2-methylquinolin-6-yl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 167306517) has the molecular formula C25H19ClN4O4S and a molecular weight of 506.97 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methylquinolin-6-yl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-(2-methylquinolin-6-yl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 167306517 |
| Molecular Formula | C25H19ClN4O4S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-[3-chloro-4-(2-methylquinolin-6-yl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1ccc2cc(-c3ccc(NS(=O)(=O)c4cc5[nH]c(=O)c(=O)[nH]c5cc4C)cc3Cl)ccc2n1 |
| InChI | InChI=1S/C25H19ClN4O4S/c1-13-9-21-22(29-25(32)24(31)28-21)12-23(13)35(33,34)30-17-6-7-18(19(26)11-17)15-5-8-20-16(10-15)4-3-14(2)27-20/h3-12,30H,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | TUXBINXOADWUMO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|