C24H20ClN3O6S — CID 166464263
ethyl 2-[2-chloro-4-[(7-methyl-2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]phenyl]benzoate (PubChem CID 166464263) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(7-methyl-2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]phenyl]benzoate.
| Compound Name | ethyl 2-[2-chloro-4-[(7-methyl-2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]phenyl]benzoate |
|---|---|
| PubChem CID | 166464263 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(7-methyl-2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]phenyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1ccc(NS(=O)(=O)c2cc3[nH]c(=O)c(=O)[nH]c3cc2C)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O6S/c1-3-34-24(31)17-7-5-4-6-15(17)16-9-8-14(11-18(16)25)28-35(32,33)21-12-20-19(10-13(21)2)26-22(29)23(30)27-20/h4-12,28H,3H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | UXGJXAHHRGFWNB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|