C22H18ClN3O6S2 — CID 167306384
N-[3-chloro-4-(4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 167306384) has the molecular formula C22H18ClN3O6S2 and a molecular weight of 519.99 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-(4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 167306384 |
| Molecular Formula | C22H18ClN3O6S2 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | N-[3-chloro-4-(4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(-c2ccc(S(C)(=O)=O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O6S2/c1-12-9-18-19(25-22(28)21(27)24-18)11-20(12)34(31,32)26-14-5-8-16(17(23)10-14)13-3-6-15(7-4-13)33(2,29)30/h3-11,26H,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | UBRZRXJDPCZWBU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 146.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|