C24H21ClN4O4S — CID 172503347
N-[4-[3-(azetidin-1-yl)phenyl]-3-chlorophenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 172503347) has the molecular formula C24H21ClN4O4S and a molecular weight of 496.98 g/mol. Its IUPAC name is N-[4-[3-(azetidin-1-yl)phenyl]-3-chlorophenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[4-[3-(azetidin-1-yl)phenyl]-3-chlorophenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 172503347 |
| Molecular Formula | C24H21ClN4O4S |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-[4-[3-(azetidin-1-yl)phenyl]-3-chlorophenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(-c2cccc(N3CCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C24H21ClN4O4S/c1-14-10-20-21(27-24(31)23(30)26-20)13-22(14)34(32,33)28-16-6-7-18(19(25)12-16)15-4-2-5-17(11-15)29-8-3-9-29/h2,4-7,10-13,28H,3,8-9H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | XBKZCSHDTBCXHT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|