C23H19Cl2N3O4S — CID 172503377
N-[3-chloro-4-(3-chlorophenyl)phenyl]-2,3-dioxo-7-propan-2-yl-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 172503377) has the molecular formula C23H19Cl2N3O4S and a molecular weight of 504.40 g/mol. Its IUPAC name is N-[3-chloro-4-(3-chlorophenyl)phenyl]-2,3-dioxo-7-propan-2-yl-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-(3-chlorophenyl)phenyl]-2,3-dioxo-7-propan-2-yl-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 172503377 |
| Molecular Formula | C23H19Cl2N3O4S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | N-[3-chloro-4-(3-chlorophenyl)phenyl]-2,3-dioxo-7-propan-2-yl-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | CC(C)c1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(-c2cccc(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl2N3O4S/c1-12(2)17-10-19-20(27-23(30)22(29)26-19)11-21(17)33(31,32)28-15-6-7-16(18(25)9-15)13-4-3-5-14(24)8-13/h3-12,28H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | WIHNLEPATQOHPM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|