C22H17ClFN3O6S2 — CID 176883710
N-[3-chloro-4-(2-fluoro-4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 176883710) has the molecular formula C22H17ClFN3O6S2 and a molecular weight of 537.98 g/mol. Its IUPAC name is N-[3-chloro-4-(2-fluoro-4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-(2-fluoro-4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 176883710 |
| Molecular Formula | C22H17ClFN3O6S2 |
| Molecular Weight | 537.98 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | N-[3-chloro-4-(2-fluoro-4-methylsulfonylphenyl)phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(-c2ccc(S(C)(=O)=O)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C22H17ClFN3O6S2/c1-11-7-18-19(26-22(29)21(28)25-18)10-20(11)35(32,33)27-12-3-5-14(16(23)8-12)15-6-4-13(9-17(15)24)34(2,30)31/h3-10,27H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | REMQNGOAGBORFI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 146.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.98 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|