C19H14ClN3O4S2 — CID 166464278
N-(3-chloro-4-thiophen-3-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 166464278) has the molecular formula C19H14ClN3O4S2 and a molecular weight of 447.93 g/mol. Its IUPAC name is N-(3-chloro-4-thiophen-3-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-(3-chloro-4-thiophen-3-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 166464278 |
| Molecular Formula | C19H14ClN3O4S2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | N-(3-chloro-4-thiophen-3-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(-c2ccsc2)c(Cl)c1 |
| InChI | InChI=1S/C19H14ClN3O4S2/c1-10-6-15-16(22-19(25)18(24)21-15)8-17(10)29(26,27)23-12-2-3-13(14(20)7-12)11-4-5-28-9-11/h2-9,23H,1H3,(H,21,24)(H,22,25) |
| InChIKey | KNZXFQJWAWFJMW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|