C20H12Cl2FN3O4S — CID 172503328
N-[3-chloro-4-(3-chlorophenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 172503328) has the molecular formula C20H12Cl2FN3O4S and a molecular weight of 480.30 g/mol. Its IUPAC name is N-[3-chloro-4-(3-chlorophenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-(3-chlorophenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 172503328 |
| Molecular Formula | C20H12Cl2FN3O4S |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | N-[3-chloro-4-(3-chlorophenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2cc(F)c(S(=O)(=O)Nc3ccc(-c4cccc(Cl)c4)c(Cl)c3)cc2[nH]c1=O |
| InChI | InChI=1S/C20H12Cl2FN3O4S/c21-11-3-1-2-10(6-11)13-5-4-12(7-14(13)22)26-31(29,30)18-9-17-16(8-15(18)23)24-19(27)20(28)25-17/h1-9,26H,(H,24,27)(H,25,28) |
| InChIKey | RILDSGQXDRJXHT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|