C24H20ClFN4O4S — CID 167306605
N-[3-chloro-4-(3-pyrrolidin-1-ylphenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 167306605) has the molecular formula C24H20ClFN4O4S and a molecular weight of 514.97 g/mol. Its IUPAC name is N-[3-chloro-4-(3-pyrrolidin-1-ylphenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-(3-pyrrolidin-1-ylphenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 167306605 |
| Molecular Formula | C24H20ClFN4O4S |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[3-chloro-4-(3-pyrrolidin-1-ylphenyl)phenyl]-7-fluoro-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2cc(F)c(S(=O)(=O)Nc3ccc(-c4cccc(N5CCCC5)c4)c(Cl)c3)cc2[nH]c1=O |
| InChI | InChI=1S/C24H20ClFN4O4S/c25-18-11-15(6-7-17(18)14-4-3-5-16(10-14)30-8-1-2-9-30)29-35(33,34)22-13-21-20(12-19(22)26)27-23(31)24(32)28-21/h3-7,10-13,29H,1-2,8-9H2,(H,27,31)(H,28,32) |
| InChIKey | OEYGFAFSYVVSTB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|