C21H16FN3O4S — CID 166464347
7-fluoro-N-(3-methyl-4-phenylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 166464347) has the molecular formula C21H16FN3O4S and a molecular weight of 425.44 g/mol. Its IUPAC name is 7-fluoro-N-(3-methyl-4-phenylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | 7-fluoro-N-(3-methyl-4-phenylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 166464347 |
| Molecular Formula | C21H16FN3O4S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 7-fluoro-N-(3-methyl-4-phenylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc3[nH]c(=O)c(=O)[nH]c3cc2F)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H16FN3O4S/c1-12-9-14(7-8-15(12)13-5-3-2-4-6-13)25-30(28,29)19-11-18-17(10-16(19)22)23-20(26)21(27)24-18/h2-11,25H,1H3,(H,23,26)(H,24,27) |
| InChIKey | AWFCOUQTOGPTCG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|