C22H18ClN3O5S — CID 167306637
N-[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 167306637) has the molecular formula C22H18ClN3O5S and a molecular weight of 471.92 g/mol. Its IUPAC name is N-[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 167306637 |
| Molecular Formula | C22H18ClN3O5S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(-c2ccccc2CO)c(Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O5S/c1-12-8-18-19(25-22(29)21(28)24-18)10-20(12)32(30,31)26-14-6-7-16(17(23)9-14)15-5-3-2-4-13(15)11-27/h2-10,26-27H,11H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | OCYPQXTYCCGWTD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|