C12H7Cl4NO4S2 — CID 121010955
2,5-dichloro-N-(2,5-dichlorophenyl)sulfonylbenzenesulfonamide (PubChem CID 121010955) has the molecular formula C12H7Cl4NO4S2 and a molecular weight of 435.14 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,5-dichlorophenyl)sulfonylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2,5-dichlorophenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 121010955 |
| Molecular Formula | C12H7Cl4NO4S2 |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.86 |
| IUPAC Name | 2,5-dichloro-N-(2,5-dichlorophenyl)sulfonylbenzenesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)c1cc(Cl)ccc1Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H7Cl4NO4S2/c13-7-1-3-9(15)11(5-7)22(18,19)17-23(20,21)12-6-8(14)2-4-10(12)16/h1-6,17H |
| InChIKey | GBSULIQSJJKXGL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |