C8H8Cl2N2O3S — CID 8500705
N'-(2,5-dichlorophenyl)sulfonylacetohydrazide (PubChem CID 8500705) has the molecular formula C8H8Cl2N2O3S and a molecular weight of 283.14 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)sulfonylacetohydrazide.
| Compound Name | N'-(2,5-dichlorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8500705 |
| Molecular Formula | C8H8Cl2N2O3S |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | N'-(2,5-dichlorophenyl)sulfonylacetohydrazide |
| SMILES | CC(=O)NNS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H8Cl2N2O3S/c1-5(13)11-12-16(14,15)8-4-6(9)2-3-7(8)10/h2-4,12H,1H3,(H,11,13) |
| InChIKey | BDOTWFJQIPKJPQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|